C25H24N2O2 — CID 142822489
2-[1-[3-[(E)-3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenyl]ethenylamino]acetaldehyde (PubChem CID 142822489) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[1-[3-[(E)-3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenyl]ethenylamino]acetaldehyde.
| Compound Name | 2-[1-[3-[(E)-3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenyl]ethenylamino]acetaldehyde |
|---|---|
| PubChem CID | 142822489 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[1-[3-[(E)-3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenyl]ethenylamino]acetaldehyde |
| SMILES | C=C(NCC=O)c1cccc(/C=C/Cn2cccc2C(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C25H24N2O2/c1-19-10-12-22(13-11-19)25(29)24-9-5-16-27(24)15-4-7-21-6-3-8-23(18-21)20(2)26-14-17-28/h3-13,16-18,26H,2,14-15H2,1H3/b7-4+ |
| InChIKey | PXQDNTVFBAFVLZ-QPJJXVBHSA-N |
| XLogP | 4.50 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|