C26H27NO4 — CID 90964109
methyl (2R)-2-[[4-[3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenyl]methoxy]propanoate (PubChem CID 90964109) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is methyl (2R)-2-[[4-[3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenyl]methoxy]propanoate.
| Compound Name | methyl (2R)-2-[[4-[3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenyl]methoxy]propanoate |
|---|---|
| PubChem CID | 90964109 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | methyl (2R)-2-[[4-[3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenyl]methoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)OCc1ccc(C=CCn2cccc2C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-19-8-14-23(15-9-19)25(28)24-7-5-17-27(24)16-4-6-21-10-12-22(13-11-21)18-31-20(2)26(29)30-3/h4-15,17,20H,16,18H2,1-3H3/t20-/m1/s1 |
| InChIKey | QGTPYNTZTQWLGD-HXUWFJFHSA-N |
| XLogP | 4.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |