C26H29NO4 — CID 142995366
2-[(4-ethenylphenyl)methoxy]propanoic acid;(1-ethylpyrrol-2-yl)-(4-methylphenyl)methanone (PubChem CID 142995366) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-[(4-ethenylphenyl)methoxy]propanoic acid;(1-ethylpyrrol-2-yl)-(4-methylphenyl)methanone.
| Compound Name | 2-[(4-ethenylphenyl)methoxy]propanoic acid;(1-ethylpyrrol-2-yl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 142995366 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-[(4-ethenylphenyl)methoxy]propanoic acid;(1-ethylpyrrol-2-yl)-(4-methylphenyl)methanone |
| SMILES | C=Cc1ccc(COC(C)C(=O)O)cc1.CCn1cccc1C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H15NO.C12H14O3/c1-3-15-10-4-5-13(15)14(16)12-8-6-11(2)7-9-12;1-3-10-4-6-11(7-5-10)8-15-9(2)12(13)14/h4-10H,3H2,1-2H3;3-7,9H,1,8H2,2H3,(H,13,14) |
| InChIKey | QWJKJUUNIAZZJB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |