C29H30N3O+ — CID 46931640
4-[2-methyl-3-[(E)-3-phenylprop-2-enyl]imidazol-3-ium-1-yl]-2,2-diphenylbutanamide (PubChem CID 46931640) has the molecular formula C29H30N3O+ and a molecular weight of 436.58 g/mol. Its IUPAC name is 4-[2-methyl-3-[(E)-3-phenylprop-2-enyl]imidazol-3-ium-1-yl]-2,2-diphenylbutanamide.
| Compound Name | 4-[2-methyl-3-[(E)-3-phenylprop-2-enyl]imidazol-3-ium-1-yl]-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 46931640 |
| Molecular Formula | C29H30N3O+ |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 4-[2-methyl-3-[(E)-3-phenylprop-2-enyl]imidazol-3-ium-1-yl]-2,2-diphenylbutanamide |
| SMILES | Cc1n(CCC(C(N)=O)(c2ccccc2)c2ccccc2)cc[n+]1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C29H29N3O/c1-24-31(20-11-14-25-12-5-2-6-13-25)22-23-32(24)21-19-29(28(30)33,26-15-7-3-8-16-26)27-17-9-4-10-18-27/h2-18,22-23H,19-21H2,1H3,(H-,30,33)/p+1/b14-11+ |
| InChIKey | UZKDEFCGNHUTNE-SDNWHVSQSA-O |
| XLogP | 4.66 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|