C7H13F6N2PS — CID 162328748
1-(ethylsulfanylmethyl)-3-methylimidazol-3-ium hexafluorophosphate (PubChem CID 162328748) has the molecular formula C7H13F6N2PS and a molecular weight of 302.22 g/mol. Its IUPAC name is 1-(ethylsulfanylmethyl)-3-methylimidazol-3-ium hexafluorophosphate.
| Compound Name | 1-(ethylsulfanylmethyl)-3-methylimidazol-3-ium hexafluorophosphate |
|---|---|
| PubChem CID | 162328748 |
| Molecular Formula | C7H13F6N2PS |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-(ethylsulfanylmethyl)-3-methylimidazol-3-ium hexafluorophosphate |
| SMILES | CCSCn1cc[n+](C)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C7H13N2S.F6P/c1-3-10-7-9-5-4-8(2)6-9;1-7(2,3,4,5)6/h4-6H,3,7H2,1-2H3;/q+1;-1 |
| InChIKey | VYXUHEUFPZZTIJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|