C10H8F13N — CID 54109001
1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidine (PubChem CID 54109001) has the molecular formula C10H8F13N and a molecular weight of 389.16 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidine.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidine |
|---|---|
| PubChem CID | 54109001 |
| Molecular Formula | C10H8F13N |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrrolidine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N1CCCC1 |
| InChI | InChI=1S/C10H8F13N/c11-5(12,7(15,16)9(19,20)21)6(13,14)8(17,18)10(22,23)24-3-1-2-4-24/h1-4H2 |
| InChIKey | NFTCYEFHTJOCFO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|