C11H10F11NO — CID 138726115
1-[2-[difluoro(3,3,3-trifluoroprop-1-en-2-yloxy)methyl]-1,1,2,3,3,3-hexafluoropropyl]pyrrolidine (PubChem CID 138726115) has the molecular formula C11H10F11NO and a molecular weight of 381.19 g/mol. Its IUPAC name is 1-[2-[difluoro(3,3,3-trifluoroprop-1-en-2-yloxy)methyl]-1,1,2,3,3,3-hexafluoropropyl]pyrrolidine.
| Compound Name | 1-[2-[difluoro(3,3,3-trifluoroprop-1-en-2-yloxy)methyl]-1,1,2,3,3,3-hexafluoropropyl]pyrrolidine |
|---|---|
| PubChem CID | 138726115 |
| Molecular Formula | C11H10F11NO |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1-[2-[difluoro(3,3,3-trifluoroprop-1-en-2-yloxy)methyl]-1,1,2,3,3,3-hexafluoropropyl]pyrrolidine |
| SMILES | C=C(OC(F)(F)C(F)(C(F)(F)F)C(F)(F)N1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H10F11NO/c1-6(7(12,13)14)24-11(21,22)8(15,9(16,17)18)10(19,20)23-4-2-3-5-23/h1-5H2 |
| InChIKey | BRYJGWNVEVSLNZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|