C11H12F9N — CID 147789534
1-[(E)-1,1,1,2,4,4,5,5,5-nonafluoropent-2-en-3-yl]azepane (PubChem CID 147789534) has the molecular formula C11H12F9N and a molecular weight of 329.21 g/mol. Its IUPAC name is 1-[(E)-1,1,1,2,4,4,5,5,5-nonafluoropent-2-en-3-yl]azepane.
| Compound Name | 1-[(E)-1,1,1,2,4,4,5,5,5-nonafluoropent-2-en-3-yl]azepane |
|---|---|
| PubChem CID | 147789534 |
| Molecular Formula | C11H12F9N |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-[(E)-1,1,1,2,4,4,5,5,5-nonafluoropent-2-en-3-yl]azepane |
| SMILES | F/C(=C(/N1CCCCCC1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F9N/c12-7(10(15,16)17)8(9(13,14)11(18,19)20)21-5-3-1-2-4-6-21/h1-6H2/b8-7+ |
| InChIKey | HJIVXGLAZPRUNN-BQYQJAHWSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|