C11H15F6N — CID 160982578
1-(2,4,4,5,5,5-hexafluoropent-2-en-3-yl)azepane (PubChem CID 160982578) has the molecular formula C11H15F6N and a molecular weight of 275.24 g/mol. Its IUPAC name is 1-(2,4,4,5,5,5-hexafluoropent-2-en-3-yl)azepane.
| Compound Name | 1-(2,4,4,5,5,5-hexafluoropent-2-en-3-yl)azepane |
|---|---|
| PubChem CID | 160982578 |
| Molecular Formula | C11H15F6N |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(2,4,4,5,5,5-hexafluoropent-2-en-3-yl)azepane |
| SMILES | CC(F)=C(N1CCCCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F6N/c1-8(12)9(10(13,14)11(15,16)17)18-6-4-2-3-5-7-18/h2-7H2,1H3 |
| InChIKey | OHXPSWFXTJXVAT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|