C9H10F8N2 — CID 129207512
1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine (PubChem CID 129207512) has the molecular formula C9H10F8N2 and a molecular weight of 298.18 g/mol. Its IUPAC name is 1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine.
| Compound Name | 1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 129207512 |
| Molecular Formula | C9H10F8N2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine |
| SMILES | C=C(F)C(F)(N1CCN(C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C9H10F8N2/c1-6(10)7(11,8(12,13)14)18-2-4-19(5-3-18)9(15,16)17/h1-5H2 |
| InChIKey | OYDLQTSOTWXHJK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|