About 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine
4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine (PubChem CID 129207498) has the molecular formula C9H11F6N
and a molecular weight of 247.18 g/mol. Its IUPAC name is 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine |
| PubChem CID | 129207498 |
| Molecular Formula | C9H11F6N |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine |
| SMILES | C=C(F)C(F)(F)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H11F6N/c1-6(10)9(14,15)16-4-2-7(3-5-16)8(11,12)13/h7H,1-5H2 |
| InChIKey | FKXVKAGTPZJANP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine?
The IUPAC name of 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine (CID 129207498) is 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine.
What is the SMILES notation for 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine?
The canonical SMILES for 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine is C=C(F)C(F)(F)N1CCC(C(F)(F)F)CC1.
What is the InChIKey of 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine?
The InChIKey is FKXVKAGTPZJANP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F6N/c1-6(10)9(14,15)16-4-2-7(3-5-16)8(11,12)13/h7H,1-5H2.
What are the key properties of 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine?
4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine has a molecular weight of 247.18 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine is sourced from PubChem (CID 129207498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).