C9H11F6N — CID 129207498
4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine (PubChem CID 129207498) has the molecular formula C9H11F6N and a molecular weight of 247.18 g/mol. Its IUPAC name is 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine.
| Compound Name | 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine |
|---|---|
| PubChem CID | 129207498 |
| Molecular Formula | C9H11F6N |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-(trifluoromethyl)-1-(1,1,2-trifluoroprop-2-enyl)piperidine |
| SMILES | C=C(F)C(F)(F)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H11F6N/c1-6(10)9(14,15)16-4-2-7(3-5-16)8(11,12)13/h7H,1-5H2 |
| InChIKey | FKXVKAGTPZJANP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|