C12H10F13NO — CID 170513623
1-[1,1,3,3,3-pentafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)-2-(trifluoromethyl)propyl]piperidine (PubChem CID 170513623) has the molecular formula C12H10F13NO and a molecular weight of 431.19 g/mol. Its IUPAC name is 1-[1,1,3,3,3-pentafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)-2-(trifluoromethyl)propyl]piperidine.
| Compound Name | 1-[1,1,3,3,3-pentafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)-2-(trifluoromethyl)propyl]piperidine |
|---|---|
| PubChem CID | 170513623 |
| Molecular Formula | C12H10F13NO |
| Molecular Weight | 431.19 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 1-[1,1,3,3,3-pentafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)-2-(trifluoromethyl)propyl]piperidine |
| SMILES | FC(F)=C(F)C(F)(F)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)N1CCCCC1 |
| InChI | InChI=1S/C12H10F13NO/c13-6(7(14)15)8(16,17)27-9(10(18,19)20,11(21,22)23)12(24,25)26-4-2-1-3-5-26/h1-5H2 |
| InChIKey | ZYXDSVSQOYHFLY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.19 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|