C9F18O — CID 170513614
1,1,1,2,2,4,4,5,5,5-decafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)-3-(trifluoromethyl)pentane (PubChem CID 170513614) has the molecular formula C9F18O and a molecular weight of 466.06 g/mol. Its IUPAC name is 1,1,1,2,2,4,4,5,5,5-decafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)-3-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,2,4,4,5,5,5-decafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)-3-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 170513614 |
| Molecular Formula | C9F18O |
| Molecular Weight | 466.06 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 1,1,1,2,2,4,4,5,5,5-decafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)-3-(trifluoromethyl)pentane |
| SMILES | FC(F)=C(F)C(F)(F)OC(C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9F18O/c10-1(2(11)12)3(13,14)28-4(7(19,20)21,5(15,16)8(22,23)24)6(17,18)9(25,26)27 |
| InChIKey | SCPCABQXQXVRPD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.06 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|