C12F22O2 — CID 20507002
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-bis(1,1,2,3,3-pentafluoroprop-2-enoxy)hexane (PubChem CID 20507002) has the molecular formula C12F22O2 and a molecular weight of 594.09 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-bis(1,1,2,3,3-pentafluoroprop-2-enoxy)hexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-bis(1,1,2,3,3-pentafluoroprop-2-enoxy)hexane |
|---|---|
| PubChem CID | 20507002 |
| Molecular Formula | C12F22O2 |
| Molecular Weight | 594.09 g/mol |
| Exact Mass | 593.95 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-bis(1,1,2,3,3-pentafluoroprop-2-enoxy)hexane |
| SMILES | FC(F)=C(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C12F22O2/c13-1(3(15)16)5(19,20)35-11(31,32)9(27,28)7(23,24)8(25,26)10(29,30)12(33,34)36-6(21,22)2(14)4(17)18 |
| InChIKey | TZLOXHKLJUZTLW-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.09 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|