C6ClF11O — CID 20525335
1-(2-chloro-1,1,3,3-tetrafluoroprop-2-enoxy)-1,1,2,2,3,3,3-heptafluoropropane (PubChem CID 20525335) has the molecular formula C6ClF11O and a molecular weight of 332.50 g/mol. Its IUPAC name is 1-(2-chloro-1,1,3,3-tetrafluoroprop-2-enoxy)-1,1,2,2,3,3,3-heptafluoropropane.
| Compound Name | 1-(2-chloro-1,1,3,3-tetrafluoroprop-2-enoxy)-1,1,2,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 20525335 |
| Molecular Formula | C6ClF11O |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 1-(2-chloro-1,1,3,3-tetrafluoroprop-2-enoxy)-1,1,2,2,3,3,3-heptafluoropropane |
| SMILES | FC(F)=C(Cl)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6ClF11O/c7-1(2(8)9)3(10,11)19-6(17,18)4(12,13)5(14,15)16 |
| InChIKey | HEHNRQFXXWUYEG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|