C6F12O2 — CID 175694142
1-[difluoro(1,2,2-trifluoroethenoxy)methoxy]-1,1,2,2,3,3,3-heptafluoropropane (PubChem CID 175694142) has the molecular formula C6F12O2 and a molecular weight of 332.04 g/mol. Its IUPAC name is 1-[difluoro(1,2,2-trifluoroethenoxy)methoxy]-1,1,2,2,3,3,3-heptafluoropropane.
| Compound Name | 1-[difluoro(1,2,2-trifluoroethenoxy)methoxy]-1,1,2,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 175694142 |
| Molecular Formula | C6F12O2 |
| Molecular Weight | 332.04 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 1-[difluoro(1,2,2-trifluoroethenoxy)methoxy]-1,1,2,2,3,3,3-heptafluoropropane |
| SMILES | FC(F)=C(F)OC(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F12O2/c7-1(8)2(9)19-6(17,18)20-5(15,16)3(10,11)4(12,13)14 |
| InChIKey | OIGQEZWXBXKGMC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.04 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|