C4F8O2 — CID 71405026
1-[difluoro(trifluoromethoxy)methoxy]-1,2,2-trifluoroethene (PubChem CID 71405026) has the molecular formula C4F8O2 and a molecular weight of 232.03 g/mol. Its IUPAC name is 1-[difluoro(trifluoromethoxy)methoxy]-1,2,2-trifluoroethene.
| Compound Name | 1-[difluoro(trifluoromethoxy)methoxy]-1,2,2-trifluoroethene |
|---|---|
| PubChem CID | 71405026 |
| Molecular Formula | C4F8O2 |
| Molecular Weight | 232.03 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 1-[difluoro(trifluoromethoxy)methoxy]-1,2,2-trifluoroethene |
| SMILES | FC(F)=C(F)OC(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C4F8O2/c5-1(6)2(7)13-4(11,12)14-3(8,9)10 |
| InChIKey | PODVJTKDNVRRMS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.03 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|