C5F8O — CID 87774691
(3Z)-1,1,2,3,4-pentafluoro-4-(trifluoromethoxy)buta-1,3-diene (PubChem CID 87774691) has the molecular formula C5F8O and a molecular weight of 228.04 g/mol. Its IUPAC name is (3Z)-1,1,2,3,4-pentafluoro-4-(trifluoromethoxy)buta-1,3-diene.
| Compound Name | (3Z)-1,1,2,3,4-pentafluoro-4-(trifluoromethoxy)buta-1,3-diene |
|---|---|
| PubChem CID | 87774691 |
| Molecular Formula | C5F8O |
| Molecular Weight | 228.04 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | (3Z)-1,1,2,3,4-pentafluoro-4-(trifluoromethoxy)buta-1,3-diene |
| SMILES | FC(F)=C(F)/C(F)=C(/F)OC(F)(F)F |
| InChI | InChI=1S/C5F8O/c6-1(3(8)9)2(7)4(10)14-5(11,12)13/b4-2+ |
| InChIKey | KYBQMYRYQOCCHA-DUXPYHPUSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.04 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|