C8F10 — CID 101227521
(3E,5E)-1,1,2,3,4,5,6,7,8,8-decafluoroocta-1,3,5,7-tetraene (PubChem CID 101227521) has the molecular formula C8F10 and a molecular weight of 286.07 g/mol. Its IUPAC name is (3E,5E)-1,1,2,3,4,5,6,7,8,8-decafluoroocta-1,3,5,7-tetraene.
| Compound Name | (3E,5E)-1,1,2,3,4,5,6,7,8,8-decafluoroocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 101227521 |
| Molecular Formula | C8F10 |
| Molecular Weight | 286.07 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | (3E,5E)-1,1,2,3,4,5,6,7,8,8-decafluoroocta-1,3,5,7-tetraene |
| SMILES | FC(F)=C(F)/C(F)=C(F)/C(F)=C(\F)C(F)=C(F)F |
| InChI | InChI=1S/C8F10/c9-1(3(11)5(13)7(15)16)2(10)4(12)6(14)8(17)18/b3-1+,4-2+ |
| InChIKey | LPAZCGTYJJIPQN-ZPUQHVIOSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.07 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|