C2HBrF4 — CID 154944232
1,1,2,2-tetrafluoroethene;hydrobromide (PubChem CID 154944232) has the molecular formula C2HBrF4 and a molecular weight of 180.93 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoroethene;hydrobromide.
| Compound Name | 1,1,2,2-tetrafluoroethene;hydrobromide |
|---|---|
| PubChem CID | 154944232 |
| Molecular Formula | C2HBrF4 |
| Molecular Weight | 180.93 g/mol |
| Exact Mass | 179.92 |
| IUPAC Name | 1,1,2,2-tetrafluoroethene;hydrobromide |
| SMILES | Br.FC(F)=C(F)F |
| InChI | InChI=1S/C2F4.BrH/c3-1(4)2(5)6;/h;1H |
| InChIKey | XLFBPFKYHIXLHV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.93 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |