C4H5F5 — CID 162622619
ethene;1,1,2,2-tetrafluoroethene;hydrofluoride (PubChem CID 162622619) has the molecular formula C4H5F5 and a molecular weight of 148.07 g/mol. Its IUPAC name is ethene;1,1,2,2-tetrafluoroethene;hydrofluoride.
| Compound Name | ethene;1,1,2,2-tetrafluoroethene;hydrofluoride |
|---|---|
| PubChem CID | 162622619 |
| Molecular Formula | C4H5F5 |
| Molecular Weight | 148.07 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | ethene;1,1,2,2-tetrafluoroethene;hydrofluoride |
| SMILES | C=C.F.FC(F)=C(F)F |
| InChI | InChI=1S/C2F4.C2H4.FH/c3-1(4)2(5)6;1-2;/h;1-2H2;1H |
| InChIKey | RDALPKXLDFZESU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.07 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|