C6H4F8 — CID 88622012
ethene;1,1,3,3,3-pentafluoro-2-(trifluoromethyl)prop-1-ene (PubChem CID 88622012) has the molecular formula C6H4F8 and a molecular weight of 228.08 g/mol. Its IUPAC name is ethene;1,1,3,3,3-pentafluoro-2-(trifluoromethyl)prop-1-ene.
| Compound Name | ethene;1,1,3,3,3-pentafluoro-2-(trifluoromethyl)prop-1-ene |
|---|---|
| PubChem CID | 88622012 |
| Molecular Formula | C6H4F8 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | ethene;1,1,3,3,3-pentafluoro-2-(trifluoromethyl)prop-1-ene |
| SMILES | C=C.FC(F)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4F8.C2H4/c5-2(6)1(3(7,8)9)4(10,11)12;1-2/h;1-2H2 |
| InChIKey | MRCAALCZHGMPHP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|