C4BrF7 — CID 564811
2-[bromo(difluoro)methyl]-1,1,3,3,3-pentafluoroprop-1-ene (PubChem CID 564811) has the molecular formula C4BrF7 and a molecular weight of 260.93 g/mol. Its IUPAC name is 2-[bromo(difluoro)methyl]-1,1,3,3,3-pentafluoroprop-1-ene.
| Compound Name | 2-[bromo(difluoro)methyl]-1,1,3,3,3-pentafluoroprop-1-ene |
|---|---|
| PubChem CID | 564811 |
| Molecular Formula | C4BrF7 |
| Molecular Weight | 260.93 g/mol |
| Exact Mass | 259.91 |
| IUPAC Name | 2-[bromo(difluoro)methyl]-1,1,3,3,3-pentafluoroprop-1-ene |
| SMILES | FC(F)=C(C(F)(F)F)C(F)(F)Br |
| InChI | InChI=1S/C4BrF7/c5-3(8,9)1(2(6)7)4(10,11)12 |
| InChIKey | WUQWKTCKIRGNQV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.93 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|