C4Br2F6 — CID 2783195
(E)-1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene (PubChem CID 2783195) has the molecular formula C4Br2F6 and a molecular weight of 321.84 g/mol. Its IUPAC name is (E)-1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene.
| Compound Name | (E)-1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene |
|---|---|
| PubChem CID | 2783195 |
| Molecular Formula | C4Br2F6 |
| Molecular Weight | 321.84 g/mol |
| Exact Mass | 319.83 |
| IUPAC Name | (E)-1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene |
| SMILES | F/C(=C(/F)C(F)(F)Br)C(F)(F)Br |
| InChI | InChI=1S/C4Br2F6/c5-3(9,10)1(7)2(8)4(6,11)12/b2-1+ |
| InChIKey | BDJHSJLEJXRSSG-OWOJBTEDSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.84 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|