C4BrF7O — CID 91199140
1-[bromo(difluoro)methoxy]-1,2,3,3,3-pentafluoroprop-1-ene (PubChem CID 91199140) has the molecular formula C4BrF7O and a molecular weight of 276.93 g/mol. Its IUPAC name is 1-[bromo(difluoro)methoxy]-1,2,3,3,3-pentafluoroprop-1-ene.
| Compound Name | 1-[bromo(difluoro)methoxy]-1,2,3,3,3-pentafluoroprop-1-ene |
|---|---|
| PubChem CID | 91199140 |
| Molecular Formula | C4BrF7O |
| Molecular Weight | 276.93 g/mol |
| Exact Mass | 275.90 |
| IUPAC Name | 1-[bromo(difluoro)methoxy]-1,2,3,3,3-pentafluoroprop-1-ene |
| SMILES | FC(OC(F)(F)Br)=C(F)C(F)(F)F |
| InChI | InChI=1S/C4BrF7O/c5-4(11,12)13-2(7)1(6)3(8,9)10 |
| InChIKey | NVXXQPJRSGZHTA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|