About (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene
(E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene (PubChem CID 23234723) has the molecular formula C4BrF7
and a molecular weight of 260.93 g/mol. Its IUPAC name is (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene.
Analyze (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene?
The IUPAC name of (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene (CID 23234723) is (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene.
What is the SMILES notation for (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene?
The canonical SMILES for (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene is F/C(=C(/Br)C(F)(F)F)C(F)(F)F.
What is the InChIKey of (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene?
The InChIKey is MLVGEIZMIFSKRK-OWOJBTEDSA-N. The full InChI is InChI=1S/C4BrF7/c5-1(3(7,8)9)2(6)4(10,11)12/b2-1+.
What are the key properties of (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene?
(E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene has a molecular weight of 260.93 g/mol, XLogP of 3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-bromo-1,1,1,3,4,4,4-heptafluorobut-2-ene is sourced from PubChem (CID 23234723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).