C8H6F8 — CID 173395165
1,1,1,2,5,6,6,6-octafluoro-3,4-dimethylhexa-2,4-diene (PubChem CID 173395165) has the molecular formula C8H6F8 and a molecular weight of 254.12 g/mol. Its IUPAC name is 1,1,1,2,5,6,6,6-octafluoro-3,4-dimethylhexa-2,4-diene.
| Compound Name | 1,1,1,2,5,6,6,6-octafluoro-3,4-dimethylhexa-2,4-diene |
|---|---|
| PubChem CID | 173395165 |
| Molecular Formula | C8H6F8 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1,1,1,2,5,6,6,6-octafluoro-3,4-dimethylhexa-2,4-diene |
| SMILES | CC(C(C)=C(F)C(F)(F)F)=C(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F8/c1-3(5(9)7(11,12)13)4(2)6(10)8(14,15)16/h1-2H3 |
| InChIKey | JYDJKDNLIURTNL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|