C9H6F12 — CID 159475239
(E)-1,1,1,2,3,4,5,5,5-nonafluoro-4-methylpent-2-ene;1,1,2-trifluoroprop-1-ene (PubChem CID 159475239) has the molecular formula C9H6F12 and a molecular weight of 342.12 g/mol. Its IUPAC name is (E)-1,1,1,2,3,4,5,5,5-nonafluoro-4-methylpent-2-ene;1,1,2-trifluoroprop-1-ene.
| Compound Name | (E)-1,1,1,2,3,4,5,5,5-nonafluoro-4-methylpent-2-ene;1,1,2-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 159475239 |
| Molecular Formula | C9H6F12 |
| Molecular Weight | 342.12 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | (E)-1,1,1,2,3,4,5,5,5-nonafluoro-4-methylpent-2-ene;1,1,2-trifluoroprop-1-ene |
| SMILES | CC(F)(/C(F)=C(\F)C(F)(F)F)C(F)(F)F.CC(F)=C(F)F |
| InChI | InChI=1S/C6H3F9.C3H3F3/c1-4(9,6(13,14)15)2(7)3(8)5(10,11)12;1-2(4)3(5)6/h1H3;1H3/b3-2+; |
| InChIKey | LWHIWIFPWPKMOG-SQQVDAMQSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.12 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |