C10H3F15 — CID 11189008
(3Z)-1,1,4,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-(trifluoromethyl)penta-1,3-diene (PubChem CID 11189008) has the molecular formula C10H3F15 and a molecular weight of 408.10 g/mol. Its IUPAC name is (3Z)-1,1,4,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-(trifluoromethyl)penta-1,3-diene.
| Compound Name | (3Z)-1,1,4,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-(trifluoromethyl)penta-1,3-diene |
|---|---|
| PubChem CID | 11189008 |
| Molecular Formula | C10H3F15 |
| Molecular Weight | 408.10 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | (3Z)-1,1,4,5,5,5-hexafluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-(trifluoromethyl)penta-1,3-diene |
| SMILES | CC(/C(C(=C(F)F)C(F)(F)F)=C(\F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H3F15/c1-6(9(20,21)22,10(23,24)25)2(4(11)8(17,18)19)3(5(12)13)7(14,15)16/h1H3/b4-2- |
| InChIKey | XFEFHDQWQIEPQL-RQOWECAXSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.10 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|