C8H6F10 — CID 59892543
1,1,1,2,5,5,5-heptafluoro-4,4-dimethyl-3-(trifluoromethyl)pent-2-ene (PubChem CID 59892543) has the molecular formula C8H6F10 and a molecular weight of 292.12 g/mol. Its IUPAC name is 1,1,1,2,5,5,5-heptafluoro-4,4-dimethyl-3-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,2,5,5,5-heptafluoro-4,4-dimethyl-3-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 59892543 |
| Molecular Formula | C8H6F10 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1,1,1,2,5,5,5-heptafluoro-4,4-dimethyl-3-(trifluoromethyl)pent-2-ene |
| SMILES | CC(C)(C(=C(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F10/c1-5(2,8(16,17)18)3(6(10,11)12)4(9)7(13,14)15/h1-2H3 |
| InChIKey | QMLVEGZRNNYWCU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |