C6H6F6 — CID 163535527
(E)-1,1,1,2,3,4-hexafluoro-4-methylpent-2-ene (PubChem CID 163535527) has the molecular formula C6H6F6 and a molecular weight of 192.10 g/mol. Its IUPAC name is (E)-1,1,1,2,3,4-hexafluoro-4-methylpent-2-ene.
| Compound Name | (E)-1,1,1,2,3,4-hexafluoro-4-methylpent-2-ene |
|---|---|
| PubChem CID | 163535527 |
| Molecular Formula | C6H6F6 |
| Molecular Weight | 192.10 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | (E)-1,1,1,2,3,4-hexafluoro-4-methylpent-2-ene |
| SMILES | CC(C)(F)/C(F)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C6H6F6/c1-5(2,9)3(7)4(8)6(10,11)12/h1-2H3/b4-3+ |
| InChIKey | RXRUFEJPFQPZON-ONEGZZNKSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.10 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |