C6H5F7 — CID 124671886
(Z)-1,1,1,2,3,4,4-heptafluorohex-2-ene (PubChem CID 124671886) has the molecular formula C6H5F7 and a molecular weight of 210.09 g/mol. Its IUPAC name is (Z)-1,1,1,2,3,4,4-heptafluorohex-2-ene.
| Compound Name | (Z)-1,1,1,2,3,4,4-heptafluorohex-2-ene |
|---|---|
| PubChem CID | 124671886 |
| Molecular Formula | C6H5F7 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | (Z)-1,1,1,2,3,4,4-heptafluorohex-2-ene |
| SMILES | CCC(F)(F)/C(F)=C(/F)C(F)(F)F |
| InChI | InChI=1S/C6H5F7/c1-2-5(9,10)3(7)4(8)6(11,12)13/h2H2,1H3/b4-3- |
| InChIKey | VMAQWIWYDVTELO-ARJAWSKDSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |