C3F6OZn — CID 158339432
zinc;1,1,2,3,3,3-hexafluoroprop-1-ene;oxygen(2-) (PubChem CID 158339432) has the molecular formula C3F6OZn and a molecular weight of 231.41 g/mol. Its IUPAC name is zinc;1,1,2,3,3,3-hexafluoroprop-1-ene;oxygen(2-).
| Compound Name | zinc;1,1,2,3,3,3-hexafluoroprop-1-ene;oxygen(2-) |
|---|---|
| PubChem CID | 158339432 |
| Molecular Formula | C3F6OZn |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 229.91 |
| IUPAC Name | zinc;1,1,2,3,3,3-hexafluoroprop-1-ene;oxygen(2-) |
| SMILES | FC(F)=C(F)C(F)(F)F.[O-2].[Zn+2] |
| InChI | InChI=1S/C3F6.O.Zn/c4-1(2(5)6)3(7,8)9;;/q;-2;+2 |
| InChIKey | GQYZNSIVNSQKIA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 28.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|