C9H8F8O — CID 174624202
1,1-difluoroethene;ethenoxyethene;1,1,2,3,3,3-hexafluoroprop-1-ene (PubChem CID 174624202) has the molecular formula C9H8F8O and a molecular weight of 284.15 g/mol. Its IUPAC name is 1,1-difluoroethene;ethenoxyethene;1,1,2,3,3,3-hexafluoroprop-1-ene.
| Compound Name | 1,1-difluoroethene;ethenoxyethene;1,1,2,3,3,3-hexafluoroprop-1-ene |
|---|---|
| PubChem CID | 174624202 |
| Molecular Formula | C9H8F8O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1,1-difluoroethene;ethenoxyethene;1,1,2,3,3,3-hexafluoroprop-1-ene |
| SMILES | C=C(F)F.C=COC=C.FC(F)=C(F)C(F)(F)F |
| InChI | InChI=1S/C4H6O.C3F6.C2H2F2/c1-3-5-4-2;4-1(2(5)6)3(7,8)9;1-2(3)4/h3-4H,1-2H2;;1H2 |
| InChIKey | VGNSFJBYMDZCEH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|