C6F10O — CID 57349567
1,2,3,3,3-pentafluoro-1-(1,2,3,3,3-pentafluoroprop-1-enoxy)prop-1-ene (PubChem CID 57349567) has the molecular formula C6F10O and a molecular weight of 278.05 g/mol. Its IUPAC name is 1,2,3,3,3-pentafluoro-1-(1,2,3,3,3-pentafluoroprop-1-enoxy)prop-1-ene.
| Compound Name | 1,2,3,3,3-pentafluoro-1-(1,2,3,3,3-pentafluoroprop-1-enoxy)prop-1-ene |
|---|---|
| PubChem CID | 57349567 |
| Molecular Formula | C6F10O |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 1,2,3,3,3-pentafluoro-1-(1,2,3,3,3-pentafluoroprop-1-enoxy)prop-1-ene |
| SMILES | FC(OC(F)=C(F)C(F)(F)F)=C(F)C(F)(F)F |
| InChI | InChI=1S/C6F10O/c7-1(5(11,12)13)3(9)17-4(10)2(8)6(14,15)16 |
| InChIKey | CSJWOWRPMBXQLD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|