C12F22O3 — CID 173022042
1,2,3,4,4,5,5,5-octafluoro-1-[1,2,3,4,4,5,5,5-octafluoro-3-(trifluoromethoxy)pent-1-enoxy]-3-(trifluoromethoxy)pent-1-ene (PubChem CID 173022042) has the molecular formula C12F22O3 and a molecular weight of 610.08 g/mol. Its IUPAC name is 1,2,3,4,4,5,5,5-octafluoro-1-[1,2,3,4,4,5,5,5-octafluoro-3-(trifluoromethoxy)pent-1-enoxy]-3-(trifluoromethoxy)pent-1-ene.
| Compound Name | 1,2,3,4,4,5,5,5-octafluoro-1-[1,2,3,4,4,5,5,5-octafluoro-3-(trifluoromethoxy)pent-1-enoxy]-3-(trifluoromethoxy)pent-1-ene |
|---|---|
| PubChem CID | 173022042 |
| Molecular Formula | C12F22O3 |
| Molecular Weight | 610.08 g/mol |
| Exact Mass | 609.95 |
| IUPAC Name | 1,2,3,4,4,5,5,5-octafluoro-1-[1,2,3,4,4,5,5,5-octafluoro-3-(trifluoromethoxy)pent-1-enoxy]-3-(trifluoromethoxy)pent-1-ene |
| SMILES | FC(OC(F)=C(F)C(F)(OC(F)(F)F)C(F)(F)C(F)(F)F)=C(F)C(F)(OC(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12F22O3/c13-1(5(17,36-11(29,30)31)7(19,20)9(23,24)25)3(15)35-4(16)2(14)6(18,37-12(32,33)34)8(21,22)10(26,27)28 |
| InChIKey | RAFKZQJAOFVEPI-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.08 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|