C16F24N2O — CID 173310680
8-(7-cyano-1,2,3,3,4,4,5,5,6,6,7,7-dodecafluorohept-1-enoxy)-2,2,3,3,4,4,5,5,6,6,7,8-dodecafluorooct-7-enenitrile (PubChem CID 173310680) has the molecular formula C16F24N2O and a molecular weight of 692.14 g/mol. Its IUPAC name is 8-(7-cyano-1,2,3,3,4,4,5,5,6,6,7,7-dodecafluorohept-1-enoxy)-2,2,3,3,4,4,5,5,6,6,7,8-dodecafluorooct-7-enenitrile.
| Compound Name | 8-(7-cyano-1,2,3,3,4,4,5,5,6,6,7,7-dodecafluorohept-1-enoxy)-2,2,3,3,4,4,5,5,6,6,7,8-dodecafluorooct-7-enenitrile |
|---|---|
| PubChem CID | 173310680 |
| Molecular Formula | C16F24N2O |
| Molecular Weight | 692.14 g/mol |
| Exact Mass | 691.96 |
| IUPAC Name | 8-(7-cyano-1,2,3,3,4,4,5,5,6,6,7,7-dodecafluorohept-1-enoxy)-2,2,3,3,4,4,5,5,6,6,7,8-dodecafluorooct-7-enenitrile |
| SMILES | N#CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)=C(F)OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C#N |
| InChI | InChI=1S/C16F24N2O/c17-3(9(25,26)13(33,34)15(37,38)11(29,30)7(21,22)1-41)5(19)43-6(20)4(18)10(27,28)14(35,36)16(39,40)12(31,32)8(23,24)2-42 |
| InChIKey | FIMWZCRLAJKPIA-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.14 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|