C10F16O — CID 173370354
1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,5,5-heptafluoropenta-1,4-dienoxy)pent-1-ene (PubChem CID 173370354) has the molecular formula C10F16O and a molecular weight of 440.08 g/mol. Its IUPAC name is 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,5,5-heptafluoropenta-1,4-dienoxy)pent-1-ene.
| Compound Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,5,5-heptafluoropenta-1,4-dienoxy)pent-1-ene |
|---|---|
| PubChem CID | 173370354 |
| Molecular Formula | C10F16O |
| Molecular Weight | 440.08 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,5,5-heptafluoropenta-1,4-dienoxy)pent-1-ene |
| SMILES | FC(F)=C(F)C(F)(F)C(F)=C(F)OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F16O/c11-1(4(14)15)7(18,19)2(12)5(16)27-6(17)3(13)8(20,21)9(22,23)10(24,25)26 |
| InChIKey | ZCMTXDMMRNPWTO-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.08 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|