C10H11F9O — CID 175759689
1,2,3,3,4,4,5,5,5-nonafluoro-1-pentoxypent-1-ene (PubChem CID 175759689) has the molecular formula C10H11F9O and a molecular weight of 318.18 g/mol. Its IUPAC name is 1,2,3,3,4,4,5,5,5-nonafluoro-1-pentoxypent-1-ene.
| Compound Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-pentoxypent-1-ene |
|---|---|
| PubChem CID | 175759689 |
| Molecular Formula | C10H11F9O |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-pentoxypent-1-ene |
| SMILES | CCCCCOC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F9O/c1-2-3-4-5-20-7(12)6(11)8(13,14)9(15,16)10(17,18)19/h2-5H2,1H3 |
| InChIKey | ZJMUSNAVGUSTFP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|