C16H24F7NO3 — CID 91737665
nonyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate (PubChem CID 91737665) has the molecular formula C16H24F7NO3 and a molecular weight of 411.36 g/mol. Its IUPAC name is nonyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate.
| Compound Name | nonyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 91737665 |
| Molecular Formula | C16H24F7NO3 |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | nonyl 2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]acetate |
| SMILES | CCCCCCCCCOC(=O)CN(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H24F7NO3/c1-3-4-5-6-7-8-9-10-27-12(25)11-24(2)13(26)14(17,18)15(19,20)16(21,22)23/h3-11H2,1-2H3 |
| InChIKey | AFHWNYPLMYTVFM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|