C8H10F7NO — CID 169289327
2,2,3,3,4,4,4-heptafluoro-N-methyl-N-propylbutanamide (PubChem CID 169289327) has the molecular formula C8H10F7NO and a molecular weight of 269.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-methyl-N-propylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-methyl-N-propylbutanamide |
|---|---|
| PubChem CID | 169289327 |
| Molecular Formula | C8H10F7NO |
| Molecular Weight | 269.16 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-methyl-N-propylbutanamide |
| SMILES | CCCN(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F7NO/c1-3-4-16(2)5(17)6(9,10)7(11,12)8(13,14)15/h3-4H2,1-2H3 |
| InChIKey | KVVNOLDGDJKDAS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|