C21H22F11NO3 — CID 139811440
octyl N-[3-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]carbamate (PubChem CID 139811440) has the molecular formula C21H22F11NO3 and a molecular weight of 545.39 g/mol. Its IUPAC name is octyl N-[3-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]carbamate.
| Compound Name | octyl N-[3-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 139811440 |
| Molecular Formula | C21H22F11NO3 |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | octyl N-[3-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]carbamate |
| SMILES | CCCCCCCCOC(=O)Nc1cccc(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F11NO3/c1-2-3-4-5-6-7-11-35-17(34)33-13-9-8-10-14(12-13)36-16(23)15(22)18(24,25)19(26,27)20(28,29)21(30,31)32/h8-10,12H,2-7,11H2,1H3,(H,33,34) |
| InChIKey | HGFDYTYJXZYSRT-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|