C29H15F17N2O5 — CID 54256665
phenyl N-[2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-4-(phenoxycarbonylamino)phenyl]carbamate (PubChem CID 54256665) has the molecular formula C29H15F17N2O5 and a molecular weight of 794.41 g/mol. Its IUPAC name is phenyl N-[2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-4-(phenoxycarbonylamino)phenyl]carbamate.
| Compound Name | phenyl N-[2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-4-(phenoxycarbonylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 54256665 |
| Molecular Formula | C29H15F17N2O5 |
| Molecular Weight | 794.41 g/mol |
| Exact Mass | 794.07 |
| IUPAC Name | phenyl N-[2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-4-(phenoxycarbonylamino)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(NC(=O)Oc2ccccc2)c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1)Oc1ccccc1 |
| InChI | InChI=1S/C29H15F17N2O5/c30-19(23(32,33)24(34,35)25(36,37)26(38,39)27(40,41)28(42,43)29(44,45)46)20(31)53-18-13-14(47-21(49)51-15-7-3-1-4-8-15)11-12-17(18)48-22(50)52-16-9-5-2-6-10-16/h1-13H,(H,47,49)(H,48,50) |
| InChIKey | RANZIAPAIPBWCK-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.41 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|