C30H23F11N2O7 — CID 139605527
(4-methoxyphenyl)methyl N-[4-[(4-methoxyphenyl)methoxycarbonylamino]-2-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]carbamate (PubChem CID 139605527) has the molecular formula C30H23F11N2O7 and a molecular weight of 732.50 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[4-[(4-methoxyphenyl)methoxycarbonylamino]-2-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[4-[(4-methoxyphenyl)methoxycarbonylamino]-2-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 139605527 |
| Molecular Formula | C30H23F11N2O7 |
| Molecular Weight | 732.50 g/mol |
| Exact Mass | 732.13 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[4-[(4-methoxyphenyl)methoxycarbonylamino]-2-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]carbamate |
| SMILES | COc1ccc(COC(=O)Nc2ccc(NC(=O)OCc3ccc(OC)cc3)c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C30H23F11N2O7/c1-46-19-8-3-16(4-9-19)14-48-25(44)42-18-7-12-21(43-26(45)49-15-17-5-10-20(47-2)11-6-17)22(13-18)50-24(32)23(31)27(33,34)28(35,36)29(37,38)30(39,40)41/h3-13H,14-15H2,1-2H3,(H,42,44)(H,43,45) |
| InChIKey | BUAZORFTHITBEI-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.50 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|