C17H19NO4 — CID 22599963
(4-methoxyphenyl)methyl N-(4-hydroxy-2,3-dimethylphenyl)carbamate (PubChem CID 22599963) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-(4-hydroxy-2,3-dimethylphenyl)carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-(4-hydroxy-2,3-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 22599963 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (4-methoxyphenyl)methyl N-(4-hydroxy-2,3-dimethylphenyl)carbamate |
| SMILES | COc1ccc(COC(=O)Nc2ccc(O)c(C)c2C)cc1 |
| InChI | InChI=1S/C17H19NO4/c1-11-12(2)16(19)9-8-15(11)18-17(20)22-10-13-4-6-14(21-3)7-5-13/h4-9,19H,10H2,1-3H3,(H,18,20) |
| InChIKey | FGVPJIKLPWIYJI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|