C15H5F17NaO — CID 162322327
CID 162322327 (PubChem CID 162322327) has the molecular formula C15H5F17NaO and a molecular weight of 547.16 g/mol.
| Compound Name | CID 162322327 |
|---|---|
| PubChem CID | 162322327 |
| Molecular Formula | C15H5F17NaO |
| Molecular Weight | 547.16 g/mol |
| Exact Mass | 547.00 |
| IUPAC Name | — |
| SMILES | FC(Oc1ccccc1)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na] |
| InChI | InChI=1S/C15H5F17O.Na/c16-7(8(17)33-6-4-2-1-3-5-6)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32;/h1-5H; |
| InChIKey | ARLDCIBOPVJRPE-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.16 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|