C16H7F17NaO4P — CID 138394917
sodium [4-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)phenyl]methyl-hydroxyphosphinate (PubChem CID 138394917) has the molecular formula C16H7F17NaO4P and a molecular weight of 640.16 g/mol. Its IUPAC name is sodium [4-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)phenyl]methyl-hydroxyphosphinate.
| Compound Name | sodium [4-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)phenyl]methyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 138394917 |
| Molecular Formula | C16H7F17NaO4P |
| Molecular Weight | 640.16 g/mol |
| Exact Mass | 639.97 |
| IUPAC Name | sodium [4-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)phenyl]methyl-hydroxyphosphinate |
| SMILES | O=P([O-])(O)Cc1ccc(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C16H8F17O4P.Na/c17-8(9(18)37-7-3-1-6(2-4-7)5-38(34,35)36)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33;/h1-4H,5H2,(H2,34,35,36);/q;+1/p-1 |
| InChIKey | FEHZEDPXNRZXCE-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|