C14H4F15NaO4S — CID 175006456
sodium 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooct-1-enoxy)benzenesulfonate (PubChem CID 175006456) has the molecular formula C14H4F15NaO4S and a molecular weight of 576.21 g/mol. Its IUPAC name is sodium 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooct-1-enoxy)benzenesulfonate.
| Compound Name | sodium 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooct-1-enoxy)benzenesulfonate |
|---|---|
| PubChem CID | 175006456 |
| Molecular Formula | C14H4F15NaO4S |
| Molecular Weight | 576.21 g/mol |
| Exact Mass | 575.95 |
| IUPAC Name | sodium 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooct-1-enoxy)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccccc1OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C14H5F15O4S.Na/c15-7(8(16)33-5-3-1-2-4-6(5)34(30,31)32)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)29;/h1-4H,(H,30,31,32);/q;+1/p-1 |
| InChIKey | VRRLIEASVXYAHG-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|