C14H6F15NaO4S — CID 175105765
sodium;benzenesulfonic acid;1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooct-1-en-1-olate (PubChem CID 175105765) has the molecular formula C14H6F15NaO4S and a molecular weight of 578.23 g/mol. Its IUPAC name is sodium;benzenesulfonic acid;1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooct-1-en-1-olate.
| Compound Name | sodium;benzenesulfonic acid;1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooct-1-en-1-olate |
|---|---|
| PubChem CID | 175105765 |
| Molecular Formula | C14H6F15NaO4S |
| Molecular Weight | 578.23 g/mol |
| Exact Mass | 577.96 |
| IUPAC Name | sodium;benzenesulfonic acid;1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooct-1-en-1-olate |
| SMILES | O=S(=O)(O)c1ccccc1.[Na+].[O-]C(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8HF15O.C6H6O3S.Na/c9-1(2(10)24)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23;7-10(8,9)6-4-2-1-3-5-6;/h24H;1-5H,(H,7,8,9);/q;;+1/p-1 |
| InChIKey | XGLAEYNDIPLKTN-UHFFFAOYSA-M |
| XLogP | 2.13 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|