C12H6F11NaO4S — CID 157297818
sodium;benzenesulfonic acid;1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-en-1-olate (PubChem CID 157297818) has the molecular formula C12H6F11NaO4S and a molecular weight of 478.21 g/mol. Its IUPAC name is sodium;benzenesulfonic acid;1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-en-1-olate.
| Compound Name | sodium;benzenesulfonic acid;1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-en-1-olate |
|---|---|
| PubChem CID | 157297818 |
| Molecular Formula | C12H6F11NaO4S |
| Molecular Weight | 478.21 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | sodium;benzenesulfonic acid;1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-en-1-olate |
| SMILES | O=S(=O)(O)c1ccccc1.[Na+].[O-]C(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF11O.C6H6O3S.Na/c7-1(2(8)18)3(9,10)4(11,12)5(13,14)6(15,16)17;7-10(8,9)6-4-2-1-3-5-6;/h18H;1-5H,(H,7,8,9);/q;;+1/p-1 |
| InChIKey | BBNVAYPKGREKFR-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|